C20H8F6N4 — CID 163875317
[2-[3,5-bis(trifluoromethyl)phenyl]-4-cyanoiminonaphthalen-1-ylidene]cyanamide (PubChem CID 163875317) has the molecular formula C20H8F6N4 and a molecular weight of 418.30 g/mol. Its IUPAC name is [2-[3,5-bis(trifluoromethyl)phenyl]-4-cyanoiminonaphthalen-1-ylidene]cyanamide.
| Compound Name | [2-[3,5-bis(trifluoromethyl)phenyl]-4-cyanoiminonaphthalen-1-ylidene]cyanamide |
|---|---|
| PubChem CID | 163875317 |
| Molecular Formula | C20H8F6N4 |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | [2-[3,5-bis(trifluoromethyl)phenyl]-4-cyanoiminonaphthalen-1-ylidene]cyanamide |
| SMILES | N#C/N=C1/C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)=C/C(=N\C#N)c2ccccc21 |
| InChI | InChI=1S/C20H8F6N4/c21-19(22,23)12-5-11(6-13(7-12)20(24,25)26)16-8-17(29-9-27)14-3-1-2-4-15(14)18(16)30-10-28/h1-8H/b29-17+,30-18+ |
| InChIKey | POIWCFDBNVOASI-YAGSLNJISA-N |
| XLogP | 5.36 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|