C24H8F12N4 — CID 118121487
[2,5-bis[3,5-bis(trifluoromethyl)phenyl]-4-cyanoiminocyclohexa-2,5-dien-1-ylidene]cyanamide (PubChem CID 118121487) has the molecular formula C24H8F12N4 and a molecular weight of 580.33 g/mol. Its IUPAC name is [2,5-bis[3,5-bis(trifluoromethyl)phenyl]-4-cyanoiminocyclohexa-2,5-dien-1-ylidene]cyanamide.
| Compound Name | [2,5-bis[3,5-bis(trifluoromethyl)phenyl]-4-cyanoiminocyclohexa-2,5-dien-1-ylidene]cyanamide |
|---|---|
| PubChem CID | 118121487 |
| Molecular Formula | C24H8F12N4 |
| Molecular Weight | 580.33 g/mol |
| Exact Mass | 580.06 |
| IUPAC Name | [2,5-bis[3,5-bis(trifluoromethyl)phenyl]-4-cyanoiminocyclohexa-2,5-dien-1-ylidene]cyanamide |
| SMILES | N#C/N=C1\C=C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)/C(=N/C#N)C=C1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H8F12N4/c25-21(26,27)13-1-11(2-14(5-13)22(28,29)30)17-7-20(40-10-38)18(8-19(17)39-9-37)12-3-15(23(31,32)33)6-16(4-12)24(34,35)36/h1-8H/b39-19+,40-20+ |
| InChIKey | JUEHHRNGDIZTTK-DVIGQUAASA-N |
| XLogP | 8.09 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.33 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|