C11H3BF6N3Na — CID 89251306
sodium [3,5-bis(trifluoromethyl)phenyl]-tricyanoboranuide (PubChem CID 89251306) has the molecular formula C11H3BF6N3Na and a molecular weight of 324.96 g/mol. Its IUPAC name is sodium [3,5-bis(trifluoromethyl)phenyl]-tricyanoboranuide.
| Compound Name | sodium [3,5-bis(trifluoromethyl)phenyl]-tricyanoboranuide |
|---|---|
| PubChem CID | 89251306 |
| Molecular Formula | C11H3BF6N3Na |
| Molecular Weight | 324.96 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | sodium [3,5-bis(trifluoromethyl)phenyl]-tricyanoboranuide |
| SMILES | N#C[B-](C#N)(C#N)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.[Na+] |
| InChI | InChI=1S/C11H3BF6N3.Na/c13-10(14,15)7-1-8(11(16,17)18)3-9(2-7)12(4-19,5-20)6-21;/h1-3H;/q-1;+1 |
| InChIKey | DTDNAZAJYXQFQU-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.96 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|