C44H24BF36NaO4 — CID 23686146
sodium tetrakis[3-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-5-(trifluoromethyl)phenyl]boranuide (PubChem CID 23686146) has the molecular formula C44H24BF36NaO4 and a molecular weight of 1334.40 g/mol. Its IUPAC name is sodium tetrakis[3-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-5-(trifluoromethyl)phenyl]boranuide.
| Compound Name | sodium tetrakis[3-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-5-(trifluoromethyl)phenyl]boranuide |
|---|---|
| PubChem CID | 23686146 |
| Molecular Formula | C44H24BF36NaO4 |
| Molecular Weight | 1334.40 g/mol |
| Exact Mass | 1334.11 |
| IUPAC Name | sodium tetrakis[3-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-5-(trifluoromethyl)phenyl]boranuide |
| SMILES | COC(c1cc([B-](c2cc(C(F)(F)F)cc(C(OC)(C(F)(F)F)C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(OC)(C(F)(F)F)C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(OC)(C(F)(F)F)C(F)(F)F)c2)cc(C(F)(F)F)c1)(C(F)(F)F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C44H24BF36O4.Na/c1-82-29(37(58,59)60,38(61,62)63)17-5-21(33(46,47)48)13-25(9-17)45(26-10-18(6-22(14-26)34(49,50)51)30(83-2,39(64,65)66)40(67,68)69,27-11-19(7-23(15-27)35(52,53)54)31(84-3,41(70,71)72)42(73,74)75)28-12-20(8-24(16-28)36(55,56)57)32(85-4,43(76,77)78)44(79,80)81;/h5-16H,1-4H3;/q-1;+1 |
| InChIKey | KZMKCRQTQPUTBL-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1334.40 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|