C48H20BF48O4- — CID 15648628
tetrakis[3-[1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propan-2-yl]-5-(trifluoromethyl)phenyl]boranuide (PubChem CID 15648628) has the molecular formula C48H20BF48O4- and a molecular weight of 1583.40 g/mol. Its IUPAC name is tetrakis[3-[1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propan-2-yl]-5-(trifluoromethyl)phenyl]boranuide.
| Compound Name | tetrakis[3-[1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propan-2-yl]-5-(trifluoromethyl)phenyl]boranuide |
|---|---|
| PubChem CID | 15648628 |
| Molecular Formula | C48H20BF48O4- |
| Molecular Weight | 1583.40 g/mol |
| Exact Mass | 1583.07 |
| IUPAC Name | tetrakis[3-[1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propan-2-yl]-5-(trifluoromethyl)phenyl]boranuide |
| SMILES | FC(F)(F)COC(c1cc([B-](c2cc(C(F)(F)F)cc(C(OCC(F)(F)F)(C(F)(F)F)C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(OCC(F)(F)F)(C(F)(F)F)C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(OCC(F)(F)F)(C(F)(F)F)C(F)(F)F)c2)cc(C(F)(F)F)c1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C48H20BF48O4/c50-29(51,52)13-98-33(41(74,75)76,42(77,78)79)17-1-21(37(62,63)64)9-25(5-17)49(26-6-18(2-22(10-26)38(65,66)67)34(43(80,81)82,44(83,84)85)99-14-30(53,54)55,27-7-19(3-23(11-27)39(68,69)70)35(45(86,87)88,46(89,90)91)100-15-31(56,57)58)28-8-20(4-24(12-28)40(71,72)73)36(47(92,93)94,48(95,96)97)101-16-32(59,60)61/h1-12H,13-16H2/q-1 |
| InChIKey | DMOZVLZZVPLVNY-UHFFFAOYSA-N |
| XLogP | 18.73 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 101 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1583.40 |
| LogP ≤ 5 | 18.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|