C12H8BF12LiO4 — CID 175237728
lithium;boric acid;1-[1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propan-2-yl]-3-(trifluoromethyl)benzene-5-ide (PubChem CID 175237728) has the molecular formula C12H8BF12LiO4 and a molecular weight of 461.92 g/mol. Its IUPAC name is lithium;boric acid;1-[1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propan-2-yl]-3-(trifluoromethyl)benzene-5-ide.
| Compound Name | lithium;boric acid;1-[1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propan-2-yl]-3-(trifluoromethyl)benzene-5-ide |
|---|---|
| PubChem CID | 175237728 |
| Molecular Formula | C12H8BF12LiO4 |
| Molecular Weight | 461.92 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | lithium;boric acid;1-[1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propan-2-yl]-3-(trifluoromethyl)benzene-5-ide |
| SMILES | FC(F)(F)COC(c1c[c-]cc(C(F)(F)F)c1)(C(F)(F)F)C(F)(F)F.OB(O)O.[Li+] |
| InChI | InChI=1S/C12H5F12O.BH3O3.Li/c13-8(14,15)5-25-9(11(19,20)21,12(22,23)24)6-2-1-3-7(4-6)10(16,17)18;2-1(3)4;/h2-4H,5H2;2-4H;/q-1;;+1 |
| InChIKey | MUMHTCWKKGILRC-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.92 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|