C32H12AgBF24 — CID 24773254
silver tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide (PubChem CID 24773254) has the molecular formula C32H12AgBF24 and a molecular weight of 971.08 g/mol. Its IUPAC name is silver tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide.
| Compound Name | silver tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
|---|---|
| PubChem CID | 24773254 |
| Molecular Formula | C32H12AgBF24 |
| Molecular Weight | 971.08 g/mol |
| Exact Mass | 969.97 |
| IUPAC Name | silver tetrakis[3,5-bis(trifluoromethyl)phenyl]boranuide |
| SMILES | FC(F)(F)c1cc([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1.[Ag+] |
| InChI | InChI=1S/C32H12BF24.Ag/c34-25(35,36)13-1-14(26(37,38)39)6-21(5-13)33(22-7-15(27(40,41)42)2-16(8-22)28(43,44)45,23-9-17(29(46,47)48)3-18(10-23)30(49,50)51)24-11-19(31(52,53)54)4-20(12-24)32(55,56)57;/h1-12H;/q-1;+1 |
| InChIKey | DNNXVTQEKMFBEH-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 971.08 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|