C27H16BF18O- — CID 162526434
tris[3,5-bis(trifluoromethyl)phenyl]-propan-2-yloxyboranuide (PubChem CID 162526434) has the molecular formula C27H16BF18O- and a molecular weight of 709.20 g/mol. Its IUPAC name is tris[3,5-bis(trifluoromethyl)phenyl]-propan-2-yloxyboranuide.
| Compound Name | tris[3,5-bis(trifluoromethyl)phenyl]-propan-2-yloxyboranuide |
|---|---|
| PubChem CID | 162526434 |
| Molecular Formula | C27H16BF18O- |
| Molecular Weight | 709.20 g/mol |
| Exact Mass | 709.10 |
| IUPAC Name | tris[3,5-bis(trifluoromethyl)phenyl]-propan-2-yloxyboranuide |
| SMILES | CC(C)O[B-](c1cc(C(F)(F)F)cc(C(F)(F)F)c1)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H16BF18O/c1-12(2)47-28(19-6-13(22(29,30)31)3-14(7-19)23(32,33)34,20-8-15(24(35,36)37)4-16(9-20)25(38,39)40)21-10-17(26(41,42)43)5-18(11-21)27(44,45)46/h3-12H,1-2H3/q-1 |
| InChIKey | VRAMVYZJWBNYOS-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.20 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|