C19H13BF12O — CID 142545368
bis[3,5-bis(trifluoromethyl)phenyl]-propan-2-yloxyborane (PubChem CID 142545368) has the molecular formula C19H13BF12O and a molecular weight of 496.10 g/mol. Its IUPAC name is bis[3,5-bis(trifluoromethyl)phenyl]-propan-2-yloxyborane.
| Compound Name | bis[3,5-bis(trifluoromethyl)phenyl]-propan-2-yloxyborane |
|---|---|
| PubChem CID | 142545368 |
| Molecular Formula | C19H13BF12O |
| Molecular Weight | 496.10 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | bis[3,5-bis(trifluoromethyl)phenyl]-propan-2-yloxyborane |
| SMILES | CC(C)OB(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H13BF12O/c1-9(2)33-20(14-5-10(16(21,22)23)3-11(6-14)17(24,25)26)15-7-12(18(27,28)29)4-13(8-15)19(30,31)32/h3-9H,1-2H3 |
| InChIKey | NYULYVMJIOPWDJ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.10 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|