C32H59BF6N2O2 — CID 141210356
[3,5-bis(trifluoromethyl)phenyl]-dioxidoborane;bis(tritert-butylazanium) (PubChem CID 141210356) has the molecular formula C32H59BF6N2O2 and a molecular weight of 628.64 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-dioxidoborane;bis(tritert-butylazanium).
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-dioxidoborane;bis(tritert-butylazanium) |
|---|---|
| PubChem CID | 141210356 |
| Molecular Formula | C32H59BF6N2O2 |
| Molecular Weight | 628.64 g/mol |
| Exact Mass | 628.46 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-dioxidoborane;bis(tritert-butylazanium) |
| SMILES | CC(C)(C)[NH+](C(C)(C)C)C(C)(C)C.CC(C)(C)[NH+](C(C)(C)C)C(C)(C)C.[O-]B([O-])c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/2C12H27N.C8H3BF6O2/c2*1-10(2,3)13(11(4,5)6)12(7,8)9;10-7(11,12)4-1-5(8(13,14)15)3-6(2-4)9(16)17/h2*1-9H3;1-3H/q;;-2/p+2 |
| InChIKey | BSYADFQRQBQTCA-UHFFFAOYSA-P |
| XLogP | 4.67 |
| TPSA | 55.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.64 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|