C12H12F6O — CID 145030942
1-butan-2-yloxy-3,5-bis(trifluoromethyl)benzene (PubChem CID 145030942) has the molecular formula C12H12F6O and a molecular weight of 286.22 g/mol. Its IUPAC name is 1-butan-2-yloxy-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-butan-2-yloxy-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 145030942 |
| Molecular Formula | C12H12F6O |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1-butan-2-yloxy-3,5-bis(trifluoromethyl)benzene |
| SMILES | CCC(C)Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F6O/c1-3-7(2)19-10-5-8(11(13,14)15)4-9(6-10)12(16,17)18/h4-7H,3H2,1-2H3 |
| InChIKey | OFTHSVBYQCBHRT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |