C11H9F6NO2 — CID 13242436
2-[3,5-bis(trifluoromethyl)phenoxy]propanamide (PubChem CID 13242436) has the molecular formula C11H9F6NO2 and a molecular weight of 301.19 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenoxy]propanamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenoxy]propanamide |
|---|---|
| PubChem CID | 13242436 |
| Molecular Formula | C11H9F6NO2 |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenoxy]propanamide |
| SMILES | CC(Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(N)=O |
| InChI | InChI=1S/C11H9F6NO2/c1-5(9(18)19)20-8-3-6(10(12,13)14)2-7(4-8)11(15,16)17/h2-5H,1H3,(H2,18,19) |
| InChIKey | ZPRVUSMSDMDKLC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |