C12H10F6O2 — CID 87431527
[3,5-bis(trifluoromethyl)phenyl] 2-methylpropanoate (PubChem CID 87431527) has the molecular formula C12H10F6O2 and a molecular weight of 300.20 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] 2-methylpropanoate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 87431527 |
| Molecular Formula | C12H10F6O2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F6O2/c1-6(2)10(19)20-9-4-7(11(13,14)15)3-8(5-9)12(16,17)18/h3-6H,1-2H3 |
| InChIKey | RZZBCHYAIABHTO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|