C10H4F6N2O2 — CID 102482514
[3,5-bis(trifluoromethyl)phenyl] 2-diazoacetate (PubChem CID 102482514) has the molecular formula C10H4F6N2O2 and a molecular weight of 298.14 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] 2-diazoacetate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] 2-diazoacetate |
|---|---|
| PubChem CID | 102482514 |
| Molecular Formula | C10H4F6N2O2 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] 2-diazoacetate |
| SMILES | [N-]=[N+]=CC(=O)Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H4F6N2O2/c11-9(12,13)5-1-6(10(14,15)16)3-7(2-5)20-8(19)4-18-17/h1-4H |
| InChIKey | IZUJMEDEMZBXAT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|