(3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid

C12H10F6O3 — CID 103548042

IUPAC(3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid
SMILESC[C@@H](CC(=O)O)Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1
InChIInChI=1S/C12H10F6O3/c1-6(2-10(19)20)21-9-4-7(11(13,14)15)3-8(5-9)12(16,17)18/h3-6H,2H2,1H3,(H,19,20)/t6-/m0/s1
InChIKeyMFTOSPGDTYXFDV-LURJTMIESA-N
MW316.20 g/mol
LogP3.97
Rot. Bonds4

About (3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid

(3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid (PubChem CID 103548042) has the molecular formula C12H10F6O3 and a molecular weight of 316.20 g/mol. Its IUPAC name is (3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid.

Molecular Properties

Compound Name(3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid
PubChem CID103548042
Molecular FormulaC12H10F6O3
Molecular Weight316.20 g/mol
Exact Mass316.05
IUPAC Name(3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid
SMILESC[C@@H](CC(=O)O)Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1
InChIInChI=1S/C12H10F6O3/c1-6(2-10(19)20)21-9-4-7(11(13,14)15)3-8(5-9)12(16,17)18/h3-6H,2H2,1H3,(H,19,20)/t6-/m0/s1
InChIKeyMFTOSPGDTYXFDV-LURJTMIESA-N
XLogP3.97
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.20
LogP ≤ 53.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid?
The IUPAC name of (3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid (CID 103548042) is (3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid.
What is the SMILES notation for (3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid?
The canonical SMILES for (3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid is C[C@@H](CC(=O)O)Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of (3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid?
The InChIKey is MFTOSPGDTYXFDV-LURJTMIESA-N. The full InChI is InChI=1S/C12H10F6O3/c1-6(2-10(19)20)21-9-4-7(11(13,14)15)3-8(5-9)12(16,17)18/h3-6H,2H2,1H3,(H,19,20)/t6-/m0/s1.
What are the key properties of (3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid?
(3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid has a molecular weight of 316.20 g/mol, XLogP of 3.97, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid is sourced from PubChem (CID 103548042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).