C12H10F6O3 — CID 103548042
(3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid (PubChem CID 103548042) has the molecular formula C12H10F6O3 and a molecular weight of 316.20 g/mol. Its IUPAC name is (3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid.
| Compound Name | (3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 103548042 |
| Molecular Formula | C12H10F6O3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | (3S)-3-[3,5-bis(trifluoromethyl)phenoxy]butanoic acid |
| SMILES | C[C@@H](CC(=O)O)Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F6O3/c1-6(2-10(19)20)21-9-4-7(11(13,14)15)3-8(5-9)12(16,17)18/h3-6H,2H2,1H3,(H,19,20)/t6-/m0/s1 |
| InChIKey | MFTOSPGDTYXFDV-LURJTMIESA-N |
| XLogP | 3.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |