C13H12F6N2O3 — CID 7796196
(2R)-2-[3,5-bis(trifluoromethyl)phenoxy]-N-(methylcarbamoyl)propanamide (PubChem CID 7796196) has the molecular formula C13H12F6N2O3 and a molecular weight of 358.24 g/mol. Its IUPAC name is (2R)-2-[3,5-bis(trifluoromethyl)phenoxy]-N-(methylcarbamoyl)propanamide.
| Compound Name | (2R)-2-[3,5-bis(trifluoromethyl)phenoxy]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 7796196 |
| Molecular Formula | C13H12F6N2O3 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | (2R)-2-[3,5-bis(trifluoromethyl)phenoxy]-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)[C@@H](C)Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F6N2O3/c1-6(10(22)21-11(23)20-2)24-9-4-7(12(14,15)16)3-8(5-9)13(17,18)19/h3-6H,1-2H3,(H2,20,21,22,23)/t6-/m1/s1 |
| InChIKey | QHGYSWHQBAEANF-ZCFIWIBFSA-N |
| XLogP | 2.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |