C13H14F6O — CID 138549851
1-(butan-2-yloxymethyl)-3,5-bis(trifluoromethyl)benzene (PubChem CID 138549851) has the molecular formula C13H14F6O and a molecular weight of 300.24 g/mol. Its IUPAC name is 1-(butan-2-yloxymethyl)-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-(butan-2-yloxymethyl)-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 138549851 |
| Molecular Formula | C13H14F6O |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-(butan-2-yloxymethyl)-3,5-bis(trifluoromethyl)benzene |
| SMILES | CCC(C)OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F6O/c1-3-8(2)20-7-9-4-10(12(14,15)16)6-11(5-9)13(17,18)19/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | WJUGBPXPWVMCLQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |