C22H25F6NO — CID 87891731
1-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-N,N,3-trimethyl-3-phenylbutan-1-amine (PubChem CID 87891731) has the molecular formula C22H25F6NO and a molecular weight of 433.44 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-N,N,3-trimethyl-3-phenylbutan-1-amine.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-N,N,3-trimethyl-3-phenylbutan-1-amine |
|---|---|
| PubChem CID | 87891731 |
| Molecular Formula | C22H25F6NO |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-N,N,3-trimethyl-3-phenylbutan-1-amine |
| SMILES | CN(C)C(CC(C)(C)c1ccccc1)OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H25F6NO/c1-20(2,16-8-6-5-7-9-16)13-19(29(3)4)30-14-15-10-17(21(23,24)25)12-18(11-15)22(26,27)28/h5-12,19H,13-14H2,1-4H3 |
| InChIKey | MKNHPHXQRMZNBT-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|