C28H26F12O4 — CID 11479327
1-[[(2S,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1,4-bis(prop-2-enoxy)butan-2-yl]oxymethyl]-3,5-bis(trifluoromethyl)benzene (PubChem CID 11479327) has the molecular formula C28H26F12O4 and a molecular weight of 654.49 g/mol. Its IUPAC name is 1-[[(2S,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1,4-bis(prop-2-enoxy)butan-2-yl]oxymethyl]-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-[[(2S,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1,4-bis(prop-2-enoxy)butan-2-yl]oxymethyl]-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 11479327 |
| Molecular Formula | C28H26F12O4 |
| Molecular Weight | 654.49 g/mol |
| Exact Mass | 654.16 |
| IUPAC Name | 1-[[(2S,3S)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1,4-bis(prop-2-enoxy)butan-2-yl]oxymethyl]-3,5-bis(trifluoromethyl)benzene |
| SMILES | C=CCOC[C@H](OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@H](COCC=C)OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H26F12O4/c1-3-5-41-15-23(43-13-17-7-19(25(29,30)31)11-20(8-17)26(32,33)34)24(16-42-6-4-2)44-14-18-9-21(27(35,36)37)12-22(10-18)28(38,39)40/h3-4,7-12,23-24H,1-2,5-6,13-16H2/t23-,24-/m0/s1 |
| InChIKey | RRQVTXASQMINRL-ZEQRLZLVSA-N |
| XLogP | 8.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.49 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|