C17H23F3O6 — CID 174797127
6-[[3-(trifluoromethyl)phenyl]methoxy]non-8-ene-1,2,3,4,5-pentol (PubChem CID 174797127) has the molecular formula C17H23F3O6 and a molecular weight of 380.36 g/mol. Its IUPAC name is 6-[[3-(trifluoromethyl)phenyl]methoxy]non-8-ene-1,2,3,4,5-pentol.
| Compound Name | 6-[[3-(trifluoromethyl)phenyl]methoxy]non-8-ene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 174797127 |
| Molecular Formula | C17H23F3O6 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 6-[[3-(trifluoromethyl)phenyl]methoxy]non-8-ene-1,2,3,4,5-pentol |
| SMILES | C=CCC(OCc1cccc(C(F)(F)F)c1)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C17H23F3O6/c1-2-4-13(15(24)16(25)14(23)12(22)8-21)26-9-10-5-3-6-11(7-10)17(18,19)20/h2-3,5-7,12-16,21-25H,1,4,8-9H2 |
| InChIKey | DROCTHXEIXFSKW-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|