C24H32F6O — CID 143178199
1-(cyclopentylmethoxymethyl)-3,5-bis(trifluoromethyl)benzene;ethane;(3Z,5Z)-hepta-1,3,5-triene (PubChem CID 143178199) has the molecular formula C24H32F6O and a molecular weight of 450.51 g/mol. Its IUPAC name is 1-(cyclopentylmethoxymethyl)-3,5-bis(trifluoromethyl)benzene;ethane;(3Z,5Z)-hepta-1,3,5-triene.
| Compound Name | 1-(cyclopentylmethoxymethyl)-3,5-bis(trifluoromethyl)benzene;ethane;(3Z,5Z)-hepta-1,3,5-triene |
|---|---|
| PubChem CID | 143178199 |
| Molecular Formula | C24H32F6O |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 1-(cyclopentylmethoxymethyl)-3,5-bis(trifluoromethyl)benzene;ethane;(3Z,5Z)-hepta-1,3,5-triene |
| SMILES | C=C/C=C\C=C/C.CC.FC(F)(F)c1cc(COCC2CCCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H16F6O.C7H10.C2H6/c16-14(17,18)12-5-11(6-13(7-12)15(19,20)21)9-22-8-10-3-1-2-4-10;1-3-5-7-6-4-2;1-2/h5-7,10H,1-4,8-9H2;3-7H,1H2,2H3;1-2H3/b;6-4-,7-5-; |
| InChIKey | NDWUHPPLEDIRTC-SBMQUTPRSA-N |
| XLogP | 8.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|