C24H28F3NO — CID 11463820
1-[[4-[3-[[3-(trifluoromethyl)phenyl]methoxymethyl]cyclobutyl]phenyl]methyl]pyrrolidine (PubChem CID 11463820) has the molecular formula C24H28F3NO and a molecular weight of 403.49 g/mol. Its IUPAC name is 1-[[4-[3-[[3-(trifluoromethyl)phenyl]methoxymethyl]cyclobutyl]phenyl]methyl]pyrrolidine.
| Compound Name | 1-[[4-[3-[[3-(trifluoromethyl)phenyl]methoxymethyl]cyclobutyl]phenyl]methyl]pyrrolidine |
|---|---|
| PubChem CID | 11463820 |
| Molecular Formula | C24H28F3NO |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 1-[[4-[3-[[3-(trifluoromethyl)phenyl]methoxymethyl]cyclobutyl]phenyl]methyl]pyrrolidine |
| SMILES | FC(F)(F)c1cccc(COCC2CC(c3ccc(CN4CCCC4)cc3)C2)c1 |
| InChI | InChI=1S/C24H28F3NO/c25-24(26,27)23-5-3-4-19(14-23)16-29-17-20-12-22(13-20)21-8-6-18(7-9-21)15-28-10-1-2-11-28/h3-9,14,20,22H,1-2,10-13,15-17H2 |
| InChIKey | VOFGUHCIGHWUBB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |