C14H16ClF3O — CID 143895164
1-[[(1S,3R)-3-chlorocyclopentyl]methoxymethyl]-3-(trifluoromethyl)benzene (PubChem CID 143895164) has the molecular formula C14H16ClF3O and a molecular weight of 292.73 g/mol. Its IUPAC name is 1-[[(1S,3R)-3-chlorocyclopentyl]methoxymethyl]-3-(trifluoromethyl)benzene.
| Compound Name | 1-[[(1S,3R)-3-chlorocyclopentyl]methoxymethyl]-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 143895164 |
| Molecular Formula | C14H16ClF3O |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 1-[[(1S,3R)-3-chlorocyclopentyl]methoxymethyl]-3-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cccc(COC[C@H]2CC[C@@H](Cl)C2)c1 |
| InChI | InChI=1S/C14H16ClF3O/c15-13-5-4-11(7-13)9-19-8-10-2-1-3-12(6-10)14(16,17)18/h1-3,6,11,13H,4-5,7-9H2/t11-,13+/m0/s1 |
| InChIKey | HPDWSVXZOXYBPW-WCQYABFASA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|