C11H14F2O — CID 169144381
1-(butan-2-yloxymethyl)-3,5-difluorobenzene (PubChem CID 169144381) has the molecular formula C11H14F2O and a molecular weight of 200.23 g/mol. Its IUPAC name is 1-(butan-2-yloxymethyl)-3,5-difluorobenzene.
| Compound Name | 1-(butan-2-yloxymethyl)-3,5-difluorobenzene |
|---|---|
| PubChem CID | 169144381 |
| Molecular Formula | C11H14F2O |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 1-(butan-2-yloxymethyl)-3,5-difluorobenzene |
| SMILES | CCC(C)OCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H14F2O/c1-3-8(2)14-7-9-4-10(12)6-11(13)5-9/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | HKYVGQWMSAANJJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |