C15H19FO2 — CID 79710714
4-[3-(butan-2-yloxymethyl)-5-fluorophenyl]but-3-yn-1-ol (PubChem CID 79710714) has the molecular formula C15H19FO2 and a molecular weight of 250.31 g/mol. Its IUPAC name is 4-[3-(butan-2-yloxymethyl)-5-fluorophenyl]but-3-yn-1-ol.
| Compound Name | 4-[3-(butan-2-yloxymethyl)-5-fluorophenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 79710714 |
| Molecular Formula | C15H19FO2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 4-[3-(butan-2-yloxymethyl)-5-fluorophenyl]but-3-yn-1-ol |
| SMILES | CCC(C)OCc1cc(F)cc(C#CCCO)c1 |
| InChI | InChI=1S/C15H19FO2/c1-3-12(2)18-11-14-8-13(6-4-5-7-17)9-15(16)10-14/h8-10,12,17H,3,5,7,11H2,1-2H3 |
| InChIKey | WMLQPSQYEMRWIX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|