C15H19FO2S — CID 79709928
3-[[3-fluoro-5-(4-hydroxybut-1-ynyl)phenyl]methylsulfanyl]-2-methylpropan-1-ol (PubChem CID 79709928) has the molecular formula C15H19FO2S and a molecular weight of 282.38 g/mol. Its IUPAC name is 3-[[3-fluoro-5-(4-hydroxybut-1-ynyl)phenyl]methylsulfanyl]-2-methylpropan-1-ol.
| Compound Name | 3-[[3-fluoro-5-(4-hydroxybut-1-ynyl)phenyl]methylsulfanyl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 79709928 |
| Molecular Formula | C15H19FO2S |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 3-[[3-fluoro-5-(4-hydroxybut-1-ynyl)phenyl]methylsulfanyl]-2-methylpropan-1-ol |
| SMILES | CC(CO)CSCc1cc(F)cc(C#CCCO)c1 |
| InChI | InChI=1S/C15H19FO2S/c1-12(9-18)10-19-11-14-6-13(4-2-3-5-17)7-15(16)8-14/h6-8,12,17-18H,3,5,9-11H2,1H3 |
| InChIKey | SMKQTVPWTOAYJI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|