C17H14F2OS — CID 79700020
4-[3-fluoro-5-[(4-fluorophenyl)sulfanylmethyl]phenyl]but-3-yn-1-ol (PubChem CID 79700020) has the molecular formula C17H14F2OS and a molecular weight of 304.36 g/mol. Its IUPAC name is 4-[3-fluoro-5-[(4-fluorophenyl)sulfanylmethyl]phenyl]but-3-yn-1-ol.
| Compound Name | 4-[3-fluoro-5-[(4-fluorophenyl)sulfanylmethyl]phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 79700020 |
| Molecular Formula | C17H14F2OS |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 4-[3-fluoro-5-[(4-fluorophenyl)sulfanylmethyl]phenyl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1cc(F)cc(CSc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H14F2OS/c18-15-4-6-17(7-5-15)21-12-14-9-13(3-1-2-8-20)10-16(19)11-14/h4-7,9-11,20H,2,8,12H2 |
| InChIKey | MGFFBMUQQKYFDN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|