C16H21FOS — CID 107754546
4-[3-fluoro-5-(2-methylbutylsulfanylmethyl)phenyl]but-3-yn-1-ol (PubChem CID 107754546) has the molecular formula C16H21FOS and a molecular weight of 280.41 g/mol. Its IUPAC name is 4-[3-fluoro-5-(2-methylbutylsulfanylmethyl)phenyl]but-3-yn-1-ol.
| Compound Name | 4-[3-fluoro-5-(2-methylbutylsulfanylmethyl)phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 107754546 |
| Molecular Formula | C16H21FOS |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 4-[3-fluoro-5-(2-methylbutylsulfanylmethyl)phenyl]but-3-yn-1-ol |
| SMILES | CCC(C)CSCc1cc(F)cc(C#CCCO)c1 |
| InChI | InChI=1S/C16H21FOS/c1-3-13(2)11-19-12-15-8-14(6-4-5-7-18)9-16(17)10-15/h8-10,13,18H,3,5,7,11-12H2,1-2H3 |
| InChIKey | RAEDUTBLSDKWJL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|