C14H13FN2OS — CID 107781498
4-[3-fluoro-5-(1H-imidazol-2-ylsulfanylmethyl)phenyl]but-3-yn-1-ol (PubChem CID 107781498) has the molecular formula C14H13FN2OS and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-[3-fluoro-5-(1H-imidazol-2-ylsulfanylmethyl)phenyl]but-3-yn-1-ol.
| Compound Name | 4-[3-fluoro-5-(1H-imidazol-2-ylsulfanylmethyl)phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 107781498 |
| Molecular Formula | C14H13FN2OS |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 4-[3-fluoro-5-(1H-imidazol-2-ylsulfanylmethyl)phenyl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1cc(F)cc(CSc2ncc[nH]2)c1 |
| InChI | InChI=1S/C14H13FN2OS/c15-13-8-11(3-1-2-6-18)7-12(9-13)10-19-14-16-4-5-17-14/h4-5,7-9,18H,2,6,10H2,(H,16,17) |
| InChIKey | JDZGNUDLHKVELO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|