C14H13FN2OS3 — CID 115383357
4-[3-fluoro-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]but-3-yn-1-ol (PubChem CID 115383357) has the molecular formula C14H13FN2OS3 and a molecular weight of 340.47 g/mol. Its IUPAC name is 4-[3-fluoro-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]but-3-yn-1-ol.
| Compound Name | 4-[3-fluoro-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 115383357 |
| Molecular Formula | C14H13FN2OS3 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 4-[3-fluoro-5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]phenyl]but-3-yn-1-ol |
| SMILES | CSc1nnc(SCc2cc(F)cc(C#CCCO)c2)s1 |
| InChI | InChI=1S/C14H13FN2OS3/c1-19-13-16-17-14(21-13)20-9-11-6-10(4-2-3-5-18)7-12(15)8-11/h6-8,18H,3,5,9H2,1H3 |
| InChIKey | IRGJESIJBHASTG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|