C15H17FO3S — CID 79710135
methyl 3-[[3-fluoro-5-(4-hydroxybut-1-ynyl)phenyl]methylsulfanyl]propanoate (PubChem CID 79710135) has the molecular formula C15H17FO3S and a molecular weight of 296.36 g/mol. Its IUPAC name is methyl 3-[[3-fluoro-5-(4-hydroxybut-1-ynyl)phenyl]methylsulfanyl]propanoate.
| Compound Name | methyl 3-[[3-fluoro-5-(4-hydroxybut-1-ynyl)phenyl]methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 79710135 |
| Molecular Formula | C15H17FO3S |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | methyl 3-[[3-fluoro-5-(4-hydroxybut-1-ynyl)phenyl]methylsulfanyl]propanoate |
| SMILES | COC(=O)CCSCc1cc(F)cc(C#CCCO)c1 |
| InChI | InChI=1S/C15H17FO3S/c1-19-15(18)5-7-20-11-13-8-12(4-2-3-6-17)9-14(16)10-13/h8-10,17H,3,5-7,11H2,1H3 |
| InChIKey | AIFQUTWXLMSFQA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|