C18H17FO2 — CID 79699501
4-[3-fluoro-5-(phenylmethoxymethyl)phenyl]but-3-yn-1-ol (PubChem CID 79699501) has the molecular formula C18H17FO2 and a molecular weight of 284.33 g/mol. Its IUPAC name is 4-[3-fluoro-5-(phenylmethoxymethyl)phenyl]but-3-yn-1-ol.
| Compound Name | 4-[3-fluoro-5-(phenylmethoxymethyl)phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 79699501 |
| Molecular Formula | C18H17FO2 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 4-[3-fluoro-5-(phenylmethoxymethyl)phenyl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1cc(F)cc(COCc2ccccc2)c1 |
| InChI | InChI=1S/C18H17FO2/c19-18-11-16(8-4-5-9-20)10-17(12-18)14-21-13-15-6-2-1-3-7-15/h1-3,6-7,10-12,20H,5,9,13-14H2 |
| InChIKey | MNDMAPZZBVUXFT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|