C12H13FO2 — CID 79709894
3-[3-(ethoxymethyl)-5-fluorophenyl]prop-2-yn-1-ol (PubChem CID 79709894) has the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. Its IUPAC name is 3-[3-(ethoxymethyl)-5-fluorophenyl]prop-2-yn-1-ol.
| Compound Name | 3-[3-(ethoxymethyl)-5-fluorophenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 79709894 |
| Molecular Formula | C12H13FO2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 3-[3-(ethoxymethyl)-5-fluorophenyl]prop-2-yn-1-ol |
| SMILES | CCOCc1cc(F)cc(C#CCO)c1 |
| InChI | InChI=1S/C12H13FO2/c1-2-15-9-11-6-10(4-3-5-14)7-12(13)8-11/h6-8,14H,2,5,9H2,1H3 |
| InChIKey | LMVGZRUYWAKCNC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|