C19H16BF9O — CID 174061604
[3,5-bis(trifluoromethyl)phenyl]-[2-methyl-5-(trifluoromethyl)phenyl]-propan-2-yloxyborane (PubChem CID 174061604) has the molecular formula C19H16BF9O and a molecular weight of 442.13 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-[2-methyl-5-(trifluoromethyl)phenyl]-propan-2-yloxyborane.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-[2-methyl-5-(trifluoromethyl)phenyl]-propan-2-yloxyborane |
|---|---|
| PubChem CID | 174061604 |
| Molecular Formula | C19H16BF9O |
| Molecular Weight | 442.13 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-[2-methyl-5-(trifluoromethyl)phenyl]-propan-2-yloxyborane |
| SMILES | Cc1ccc(C(F)(F)F)cc1B(OC(C)C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16BF9O/c1-10(2)30-20(16-9-12(17(21,22)23)5-4-11(16)3)15-7-13(18(24,25)26)6-14(8-15)19(27,28)29/h4-10H,1-3H3 |
| InChIKey | XEHJECHEXQDUHJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.13 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|