C9H11BF6 — CID 157423256
[3,5-bis(trifluoromethyl)phenyl]boranuide;hydron;methane (PubChem CID 157423256) has the molecular formula C9H11BF6 and a molecular weight of 243.99 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]boranuide;hydron;methane.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]boranuide;hydron;methane |
|---|---|
| PubChem CID | 157423256 |
| Molecular Formula | C9H11BF6 |
| Molecular Weight | 243.99 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]boranuide;hydron;methane |
| SMILES | C.[BH3-]c1cc(C(F)(F)F)cc(C(F)(F)F)c1.[H+] |
| InChI | InChI=1S/C8H6BF6.CH4/c9-6-2-4(7(10,11)12)1-5(3-6)8(13,14)15;/h1-3H,9H3;1H4/q-1;/p+1 |
| InChIKey | BPQTVEIKAWBUEC-UHFFFAOYSA-O |
| XLogP | 2.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.99 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|