C24H9AsF18 — CID 71356716
tris[3,5-bis(trifluoromethyl)phenyl]arsane (PubChem CID 71356716) has the molecular formula C24H9AsF18 and a molecular weight of 714.22 g/mol. Its IUPAC name is tris[3,5-bis(trifluoromethyl)phenyl]arsane.
| Compound Name | tris[3,5-bis(trifluoromethyl)phenyl]arsane |
|---|---|
| PubChem CID | 71356716 |
| Molecular Formula | C24H9AsF18 |
| Molecular Weight | 714.22 g/mol |
| Exact Mass | 713.96 |
| IUPAC Name | tris[3,5-bis(trifluoromethyl)phenyl]arsane |
| SMILES | FC(F)(F)c1cc([As](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H9AsF18/c26-19(27,28)10-1-11(20(29,30)31)5-16(4-10)25(17-6-12(21(32,33)34)2-13(7-17)22(35,36)37)18-8-14(23(38,39)40)3-15(9-18)24(41,42)43/h1-9H |
| InChIKey | XNNUPGMXGLEJAS-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.22 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|