C24H8F6N4 — CID 90206169
[10-cyanoimino-2,8-bis(trifluoromethyl)indeno[2,1-b]fluoren-12-ylidene]cyanamide (PubChem CID 90206169) has the molecular formula C24H8F6N4 and a molecular weight of 466.34 g/mol. Its IUPAC name is [10-cyanoimino-2,8-bis(trifluoromethyl)indeno[2,1-b]fluoren-12-ylidene]cyanamide.
| Compound Name | [10-cyanoimino-2,8-bis(trifluoromethyl)indeno[2,1-b]fluoren-12-ylidene]cyanamide |
|---|---|
| PubChem CID | 90206169 |
| Molecular Formula | C24H8F6N4 |
| Molecular Weight | 466.34 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | [10-cyanoimino-2,8-bis(trifluoromethyl)indeno[2,1-b]fluoren-12-ylidene]cyanamide |
| SMILES | N#C/N=c1\c2cc(C(F)(F)F)ccc2c2cc3c(cc12)/c(=N/C#N)c1cc(C(F)(F)F)ccc13 |
| InChI | InChI=1S/C24H8F6N4/c25-23(26,27)11-1-3-13-15-7-16-14-4-2-12(24(28,29)30)6-18(14)22(34-10-32)20(16)8-19(15)21(33-9-31)17(13)5-11/h1-8H/b33-21+,34-22+ |
| InChIKey | IVMGZDQQUMAAFK-WXGDAXOSSA-N |
| XLogP | 5.98 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.34 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|