C30H15F3N4 — CID 162567490
[6-cyanoimino-8-methyl-2-[4-(trifluoromethyl)phenyl]indeno[1,2-b]fluoren-12-ylidene]cyanamide (PubChem CID 162567490) has the molecular formula C30H15F3N4 and a molecular weight of 488.47 g/mol. Its IUPAC name is [6-cyanoimino-8-methyl-2-[4-(trifluoromethyl)phenyl]indeno[1,2-b]fluoren-12-ylidene]cyanamide.
| Compound Name | [6-cyanoimino-8-methyl-2-[4-(trifluoromethyl)phenyl]indeno[1,2-b]fluoren-12-ylidene]cyanamide |
|---|---|
| PubChem CID | 162567490 |
| Molecular Formula | C30H15F3N4 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | [6-cyanoimino-8-methyl-2-[4-(trifluoromethyl)phenyl]indeno[1,2-b]fluoren-12-ylidene]cyanamide |
| SMILES | Cc1ccc2c(c1)/c(=N\C#N)c1cc3c(cc12)/c(=N/C#N)c1cc(-c2ccc(C(F)(F)F)cc2)ccc13 |
| InChI | InChI=1S/C30H15F3N4/c1-16-2-8-20-22-12-27-23(13-26(22)28(36-14-34)24(20)10-16)21-9-5-18(11-25(21)29(27)37-15-35)17-3-6-19(7-4-17)30(31,32)33/h2-13H,1H3/b36-28+,37-29+ |
| InChIKey | CKILQMUVWMFKBB-AQLKTEAHSA-N |
| XLogP | 6.93 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|