C35H17F3N4 — CID 123831706
[(6Z)-6-isocyanoimino-8-(4-phenylphenyl)-2-(trifluoromethyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide (PubChem CID 123831706) has the molecular formula C35H17F3N4 and a molecular weight of 550.54 g/mol. Its IUPAC name is [(6Z)-6-isocyanoimino-8-(4-phenylphenyl)-2-(trifluoromethyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide.
| Compound Name | [(6Z)-6-isocyanoimino-8-(4-phenylphenyl)-2-(trifluoromethyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide |
|---|---|
| PubChem CID | 123831706 |
| Molecular Formula | C35H17F3N4 |
| Molecular Weight | 550.54 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | [(6Z)-6-isocyanoimino-8-(4-phenylphenyl)-2-(trifluoromethyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide |
| SMILES | [C-]#[N+]/N=c1/c2cc(-c3ccc(-c4ccccc4)cc3)ccc2c2cc3/c(=N/C#N)c4cc(C(F)(F)F)ccc4c3cc12 |
| InChI | InChI=1S/C35H17F3N4/c1-40-42-34-29-15-23(22-9-7-21(8-10-22)20-5-3-2-4-6-20)11-13-25(29)28-17-31-27(18-32(28)34)26-14-12-24(35(36,37)38)16-30(26)33(31)41-19-39/h2-18H/b41-33+,42-34- |
| InChIKey | BHPKCXOCSVDBGA-ZCYRKRMFSA-N |
| XLogP | 8.64 |
| TPSA | 52.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.54 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|