C36H16N6 — CID 123516819
[(6Z)-2-(4-cyanophenyl)-6-isocyanoimino-8-(4-isocyanophenyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide (PubChem CID 123516819) has the molecular formula C36H16N6 and a molecular weight of 532.57 g/mol. Its IUPAC name is [(6Z)-2-(4-cyanophenyl)-6-isocyanoimino-8-(4-isocyanophenyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide.
| Compound Name | [(6Z)-2-(4-cyanophenyl)-6-isocyanoimino-8-(4-isocyanophenyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide |
|---|---|
| PubChem CID | 123516819 |
| Molecular Formula | C36H16N6 |
| Molecular Weight | 532.57 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | [(6Z)-2-(4-cyanophenyl)-6-isocyanoimino-8-(4-isocyanophenyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide |
| SMILES | [C-]#[N+]/N=c1/c2cc(-c3ccc([N+]#[C-])cc3)ccc2c2cc3/c(=N/C#N)c4cc(-c5ccc(C#N)cc5)ccc4c3cc12 |
| InChI | InChI=1S/C36H16N6/c1-39-26-11-7-23(8-12-26)25-10-14-28-30-17-33-29(18-34(30)36(42-40-2)32(28)16-25)27-13-9-24(15-31(27)35(33)41-20-38)22-5-3-21(19-37)4-6-22/h3-18H/b41-35+,42-36- |
| InChIKey | CCAQUJHWUWUHJJ-PZDGROLOSA-N |
| XLogP | 8.05 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.57 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|