C36H16F6N4O2 — CID 90740041
[6-isocyanoimino-2,8-bis[4-(trifluoromethyl)phenoxy]indeno[1,2-b]fluoren-12-ylidene]cyanamide (PubChem CID 90740041) has the molecular formula C36H16F6N4O2 and a molecular weight of 650.54 g/mol. Its IUPAC name is [6-isocyanoimino-2,8-bis[4-(trifluoromethyl)phenoxy]indeno[1,2-b]fluoren-12-ylidene]cyanamide.
| Compound Name | [6-isocyanoimino-2,8-bis[4-(trifluoromethyl)phenoxy]indeno[1,2-b]fluoren-12-ylidene]cyanamide |
|---|---|
| PubChem CID | 90740041 |
| Molecular Formula | C36H16F6N4O2 |
| Molecular Weight | 650.54 g/mol |
| Exact Mass | 650.12 |
| IUPAC Name | [6-isocyanoimino-2,8-bis[4-(trifluoromethyl)phenoxy]indeno[1,2-b]fluoren-12-ylidene]cyanamide |
| SMILES | [C-]#[N+]N=c1c2cc(Oc3ccc(C(F)(F)F)cc3)ccc2c2cc3/c(=N/C#N)c4cc(Oc5ccc(C(F)(F)F)cc5)ccc4c3cc12 |
| InChI | InChI=1S/C36H16F6N4O2/c1-44-46-34-30-15-24(48-22-8-4-20(5-9-22)36(40,41)42)11-13-26(30)28-16-31-27(17-32(28)34)25-12-10-23(14-29(25)33(31)45-18-43)47-21-6-2-19(3-7-21)35(37,38)39/h2-17H/b45-33+,46-34? |
| InChIKey | RJOAFPMZXWVSTG-ZBCNBCKZSA-N |
| XLogP | 9.91 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.54 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|