C22H6F6N4O2S — CID 134386233
[13-cyanoimino-6,16-bis(trifluoromethoxy)-11-thiapentacyclo[10.7.0.02,10.03,8.014,19]nonadeca-1(12),2(10),3(8),4,6,14(19),15,17-octaen-9-ylidene]cyanamide (PubChem CID 134386233) has the molecular formula C22H6F6N4O2S and a molecular weight of 504.37 g/mol. Its IUPAC name is [13-cyanoimino-6,16-bis(trifluoromethoxy)-11-thiapentacyclo[10.7.0.02,10.03,8.014,19]nonadeca-1(12),2(10),3(8),4,6,14(19),15,17-octaen-9-ylidene]cyanamide.
| Compound Name | [13-cyanoimino-6,16-bis(trifluoromethoxy)-11-thiapentacyclo[10.7.0.02,10.03,8.014,19]nonadeca-1(12),2(10),3(8),4,6,14(19),15,17-octaen-9-ylidene]cyanamide |
|---|---|
| PubChem CID | 134386233 |
| Molecular Formula | C22H6F6N4O2S |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 504.01 |
| IUPAC Name | [13-cyanoimino-6,16-bis(trifluoromethoxy)-11-thiapentacyclo[10.7.0.02,10.03,8.014,19]nonadeca-1(12),2(10),3(8),4,6,14(19),15,17-octaen-9-ylidene]cyanamide |
| SMILES | N#C/N=c1\c2cc(OC(F)(F)F)ccc2c2c1sc1/c(=N/C#N)c3cc(OC(F)(F)F)ccc3c12 |
| InChI | InChI=1S/C22H6F6N4O2S/c23-21(24,25)33-9-1-3-11-13(5-9)17(31-7-29)19-15(11)16-12-4-2-10(34-22(26,27)28)6-14(12)18(32-8-30)20(16)35-19/h1-6H/b31-17+,32-18+ |
| InChIKey | ZYGXKEWOYZGCNL-LTTYKRRRSA-N |
| XLogP | 5.80 |
| TPSA | 90.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|