C34H16F2N4 — CID 91155803
[2,8-bis(4-fluorophenyl)-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide (PubChem CID 91155803) has the molecular formula C34H16F2N4 and a molecular weight of 518.53 g/mol. Its IUPAC name is [2,8-bis(4-fluorophenyl)-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide.
| Compound Name | [2,8-bis(4-fluorophenyl)-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide |
|---|---|
| PubChem CID | 91155803 |
| Molecular Formula | C34H16F2N4 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | [2,8-bis(4-fluorophenyl)-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide |
| SMILES | [C-]#[N+]N=c1c2cc(-c3ccc(F)cc3)ccc2c2cc3/c(=N/C#N)c4cc(-c5ccc(F)cc5)ccc4c3cc12 |
| InChI | InChI=1S/C34H16F2N4/c1-38-40-34-30-15-22(20-4-10-24(36)11-5-20)7-13-26(30)28-16-31-27(17-32(28)34)25-12-6-21(14-29(25)33(31)39-18-37)19-2-8-23(35)9-3-19/h2-17H/b39-33+,40-34? |
| InChIKey | DQNYPWMIWGZSGS-MMCITWQHSA-N |
| XLogP | 7.90 |
| TPSA | 52.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|