C22H8F2N4 — CID 123582649
[(6E)-2,8-difluoro-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide (PubChem CID 123582649) has the molecular formula C22H8F2N4 and a molecular weight of 366.33 g/mol. Its IUPAC name is [(6E)-2,8-difluoro-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide.
| Compound Name | [(6E)-2,8-difluoro-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide |
|---|---|
| PubChem CID | 123582649 |
| Molecular Formula | C22H8F2N4 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | [(6E)-2,8-difluoro-6-isocyanoiminoindeno[1,2-b]fluoren-12-ylidene]cyanamide |
| SMILES | [C-]#[N+]/N=c1/c2cc(F)ccc2c2cc3/c(=N/C#N)c4cc(F)ccc4c3cc12 |
| InChI | InChI=1S/C22H8F2N4/c1-26-28-22-18-7-12(24)3-5-14(18)16-8-19-15(9-20(16)22)13-4-2-11(23)6-17(13)21(19)27-10-25/h2-9H/b27-21+,28-22- |
| InChIKey | RNVNPSOMFXCOJC-PLNZPELQSA-N |
| XLogP | 4.57 |
| TPSA | 52.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|