C42H22N4 — CID 88884274
(10-cyanoimino-2,8-dinaphthalen-2-ylindeno[2,1-b]fluoren-12-ylidene)cyanamide (PubChem CID 88884274) has the molecular formula C42H22N4 and a molecular weight of 582.67 g/mol. Its IUPAC name is (10-cyanoimino-2,8-dinaphthalen-2-ylindeno[2,1-b]fluoren-12-ylidene)cyanamide.
| Compound Name | (10-cyanoimino-2,8-dinaphthalen-2-ylindeno[2,1-b]fluoren-12-ylidene)cyanamide |
|---|---|
| PubChem CID | 88884274 |
| Molecular Formula | C42H22N4 |
| Molecular Weight | 582.67 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | (10-cyanoimino-2,8-dinaphthalen-2-ylindeno[2,1-b]fluoren-12-ylidene)cyanamide |
| SMILES | N#C/N=c1\c2cc(-c3ccc4ccccc4c3)ccc2c2cc3c(cc12)/c(=N/C#N)c1cc(-c2ccc4ccccc4c2)ccc13 |
| InChI | InChI=1S/C42H22N4/c43-23-45-41-37-19-31(29-11-9-25-5-1-3-7-27(25)17-29)13-15-33(37)35-21-36-34-16-14-32(30-12-10-26-6-2-4-8-28(26)18-30)20-38(34)42(46-24-44)40(36)22-39(35)41/h1-22H/b45-41+,46-42+ |
| InChIKey | HNRYERCDYOXRHP-UWXPRHHASA-N |
| XLogP | 9.58 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.67 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|