C34H14F6N6 — CID 58012958
10-N,20-N-diisocyano-7-[3-(trifluoromethyl)phenyl]-17-[4-(trifluoromethyl)phenyl]-2,12-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4(9),5,7,11,14(19),15,17-nonaene-10,20-diimine (PubChem CID 58012958) has the molecular formula C34H14F6N6 and a molecular weight of 620.52 g/mol. Its IUPAC name is 10-N,20-N-diisocyano-7-[3-(trifluoromethyl)phenyl]-17-[4-(trifluoromethyl)phenyl]-2,12-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4(9),5,7,11,14(19),15,17-nonaene-10,20-diimine.
| Compound Name | 10-N,20-N-diisocyano-7-[3-(trifluoromethyl)phenyl]-17-[4-(trifluoromethyl)phenyl]-2,12-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4(9),5,7,11,14(19),15,17-nonaene-10,20-diimine |
|---|---|
| PubChem CID | 58012958 |
| Molecular Formula | C34H14F6N6 |
| Molecular Weight | 620.52 g/mol |
| Exact Mass | 620.12 |
| IUPAC Name | 10-N,20-N-diisocyano-7-[3-(trifluoromethyl)phenyl]-17-[4-(trifluoromethyl)phenyl]-2,12-diazapentacyclo[11.7.0.03,11.04,9.014,19]icosa-1(13),2,4(9),5,7,11,14(19),15,17-nonaene-10,20-diimine |
| SMILES | [C-]#[N+]/N=c1/c2cc(-c3ccc(C(F)(F)F)cc3)ccc2c2nc3/c(=N/[N+]#[C-])c4cc(-c5cccc(C(F)(F)F)c5)ccc4c3nc12 |
| InChI | InChI=1S/C34H14F6N6/c1-41-45-29-25-15-19(17-6-10-21(11-7-17)33(35,36)37)8-12-23(25)27-31(29)44-28-24-13-9-20(16-26(24)30(46-42-2)32(28)43-27)18-4-3-5-22(14-18)34(38,39)40/h3-16H/b45-29-,46-30+ |
| InChIKey | CDVYEULJXXFKMO-RCKXDGJVSA-N |
| XLogP | 8.81 |
| TPSA | 59.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.52 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|