C35H17F6N3 — CID 144950147
[6-imino-5,11-diphenyl-2,8-bis(trifluoromethyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide (PubChem CID 144950147) has the molecular formula C35H17F6N3 and a molecular weight of 593.53 g/mol. Its IUPAC name is [6-imino-5,11-diphenyl-2,8-bis(trifluoromethyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide.
| Compound Name | [6-imino-5,11-diphenyl-2,8-bis(trifluoromethyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide |
|---|---|
| PubChem CID | 144950147 |
| Molecular Formula | C35H17F6N3 |
| Molecular Weight | 593.53 g/mol |
| Exact Mass | 593.13 |
| IUPAC Name | [6-imino-5,11-diphenyl-2,8-bis(trifluoromethyl)indeno[1,2-b]fluoren-12-ylidene]cyanamide |
| SMILES | [H]/N=c1\c2cc(C(F)(F)F)ccc2c2c(-c3ccccc3)c3/c(=N/C#N)c4cc(C(F)(F)F)ccc4c3c(-c3ccccc3)c12 |
| InChI | InChI=1S/C35H17F6N3/c36-34(37,38)20-11-13-22-24(15-20)32(43)30-26(18-7-3-1-4-8-18)29-23-14-12-21(35(39,40)41)16-25(23)33(44-17-42)31(29)27(28(22)30)19-9-5-2-6-10-19/h1-16,43H/b43-32+,44-33+ |
| InChIKey | VFMPERSWDQZVOF-UZSGGMMBSA-N |
| XLogP | 9.41 |
| TPSA | 60.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.53 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|