C17H7F6N3 — CID 89258727
[10-imino-2,6-bis(trifluoromethyl)anthracen-9-ylidene]cyanamide (PubChem CID 89258727) has the molecular formula C17H7F6N3 and a molecular weight of 367.25 g/mol. Its IUPAC name is [10-imino-2,6-bis(trifluoromethyl)anthracen-9-ylidene]cyanamide.
| Compound Name | [10-imino-2,6-bis(trifluoromethyl)anthracen-9-ylidene]cyanamide |
|---|---|
| PubChem CID | 89258727 |
| Molecular Formula | C17H7F6N3 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | [10-imino-2,6-bis(trifluoromethyl)anthracen-9-ylidene]cyanamide |
| SMILES | [H]/N=C1/c2cc(C(F)(F)F)ccc2/C(=N\C#N)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C17H7F6N3/c18-16(19,20)8-2-4-11-12(5-8)14(25)10-3-1-9(17(21,22)23)6-13(10)15(11)26-7-24/h1-6,25H/b25-14+,26-15+ |
| InChIKey | ALASEENFPYEMKS-LVSXPEEVSA-N |
| XLogP | 4.77 |
| TPSA | 60.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|