C18H4F12N2 — CID 153207602
[2,3,6,7-tetrakis(trifluoromethyl)fluoren-9-ylidene]cyanamide (PubChem CID 153207602) has the molecular formula C18H4F12N2 and a molecular weight of 476.22 g/mol. Its IUPAC name is [2,3,6,7-tetrakis(trifluoromethyl)fluoren-9-ylidene]cyanamide.
| Compound Name | [2,3,6,7-tetrakis(trifluoromethyl)fluoren-9-ylidene]cyanamide |
|---|---|
| PubChem CID | 153207602 |
| Molecular Formula | C18H4F12N2 |
| Molecular Weight | 476.22 g/mol |
| Exact Mass | 476.02 |
| IUPAC Name | [2,3,6,7-tetrakis(trifluoromethyl)fluoren-9-ylidene]cyanamide |
| SMILES | N#CN=C1c2cc(C(F)(F)F)c(C(F)(F)F)cc2-c2cc(C(F)(F)F)c(C(F)(F)F)cc21 |
| InChI | InChI=1S/C18H4F12N2/c19-15(20,21)10-1-6-7-2-11(16(22,23)24)13(18(28,29)30)4-9(7)14(32-5-31)8(6)3-12(10)17(25,26)27/h1-4H |
| InChIKey | WLDIEXWMCJDWBF-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.22 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|