C26H12F6N4 — CID 154028921
[2,7-dipyridin-2-yl-3,6-bis(trifluoromethyl)fluoren-9-ylidene]cyanamide (PubChem CID 154028921) has the molecular formula C26H12F6N4 and a molecular weight of 494.40 g/mol. Its IUPAC name is [2,7-dipyridin-2-yl-3,6-bis(trifluoromethyl)fluoren-9-ylidene]cyanamide.
| Compound Name | [2,7-dipyridin-2-yl-3,6-bis(trifluoromethyl)fluoren-9-ylidene]cyanamide |
|---|---|
| PubChem CID | 154028921 |
| Molecular Formula | C26H12F6N4 |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | [2,7-dipyridin-2-yl-3,6-bis(trifluoromethyl)fluoren-9-ylidene]cyanamide |
| SMILES | N#CN=C1c2cc(-c3ccccn3)c(C(F)(F)F)cc2-c2cc(C(F)(F)F)c(-c3ccccn3)cc21 |
| InChI | InChI=1S/C26H12F6N4/c27-25(28,29)20-11-14-15-12-21(26(30,31)32)19(23-6-2-4-8-35-23)10-17(15)24(36-13-33)16(14)9-18(20)22-5-1-3-7-34-22/h1-12H |
| InChIKey | SEXBLDRHJAXMQH-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 61.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|